C14H17N — CID 126661807
N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-1-phenylethanimine (PubChem CID 126661807) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-1-phenylethanimine.
| Compound Name | N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-1-phenylethanimine |
|---|---|
| PubChem CID | 126661807 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-1-phenylethanimine |
| SMILES | C=C(C)C(=C/C)/N=C(\C)c1ccccc1 |
| InChI | InChI=1S/C14H17N/c1-5-14(11(2)3)15-12(4)13-9-7-6-8-10-13/h5-10H,2H2,1,3-4H3/b14-5-,15-12+ |
| InChIKey | WWYLFSFVRDZYFI-WIRLBKNSSA-N |
| XLogP | 3.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|