C22H19N — CID 14709228
N-[(E)-1,2-diphenylethenyl]-1-phenylethanimine (PubChem CID 14709228) has the molecular formula C22H19N and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(E)-1,2-diphenylethenyl]-1-phenylethanimine.
| Compound Name | N-[(E)-1,2-diphenylethenyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 14709228 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[(E)-1,2-diphenylethenyl]-1-phenylethanimine |
| SMILES | C/C(=N\C(=C\c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19N/c1-18(20-13-7-3-8-14-20)23-22(21-15-9-4-10-16-21)17-19-11-5-2-6-12-19/h2-17H,1H3/b22-17+,23-18+ |
| InChIKey | FXDARKHFURHWMH-SKWBHROBSA-N |
| XLogP | 5.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|