C20H25N3 — CID 118609568
N-(1,2-diphenylethenyldiazenyl)-N-propan-2-ylpropan-2-amine (PubChem CID 118609568) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-(1,2-diphenylethenyldiazenyl)-N-propan-2-ylpropan-2-amine.
| Compound Name | N-(1,2-diphenylethenyldiazenyl)-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 118609568 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-(1,2-diphenylethenyldiazenyl)-N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)N(/N=N/C(=Cc1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C20H25N3/c1-16(2)23(17(3)4)22-21-20(19-13-9-6-10-14-19)15-18-11-7-5-8-12-18/h5-17H,1-4H3/b20-15?,22-21+ |
| InChIKey | HKZAFOZZUKXYRJ-QVDJGPNKSA-N |
| XLogP | 5.67 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|