C14H12N8 — CID 54015995
diazenyl-[(1,2-diphenylethenyldiazenyl)diazenyl]diazene (PubChem CID 54015995) has the molecular formula C14H12N8 and a molecular weight of 292.31 g/mol. Its IUPAC name is diazenyl-[(1,2-diphenylethenyldiazenyl)diazenyl]diazene.
| Compound Name | diazenyl-[(1,2-diphenylethenyldiazenyl)diazenyl]diazene |
|---|---|
| PubChem CID | 54015995 |
| Molecular Formula | C14H12N8 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | diazenyl-[(1,2-diphenylethenyldiazenyl)diazenyl]diazene |
| SMILES | [H]/N=N/N=NN=N/N=N/C(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12N8/c15-17-19-21-22-20-18-16-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11,15H/b14-11?,17-15+,18-16+,21-19?,22-20? |
| InChIKey | KVQZXPGNHWTMNU-PPDDUHKDSA-N |
| XLogP | 5.32 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|