About chloro(1,2-diphenylethenyl)silane
chloro(1,2-diphenylethenyl)silane (PubChem CID 123632662) has the molecular formula C14H13ClSi
and a molecular weight of 244.80 g/mol. Its IUPAC name is chloro(1,2-diphenylethenyl)silane.
Molecular Properties
| Compound Name | chloro(1,2-diphenylethenyl)silane |
| PubChem CID | 123632662 |
| Molecular Formula | C14H13ClSi |
| Molecular Weight | 244.80 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | chloro(1,2-diphenylethenyl)silane |
| SMILES | Cl[SiH2]C(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13ClSi/c15-16-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,16H2 |
| InChIKey | XOBHUOJJJBZUQL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze chloro(1,2-diphenylethenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(1,2-diphenylethenyl)silane?
The IUPAC name of chloro(1,2-diphenylethenyl)silane (CID 123632662) is chloro(1,2-diphenylethenyl)silane.
What is the SMILES notation for chloro(1,2-diphenylethenyl)silane?
The canonical SMILES for chloro(1,2-diphenylethenyl)silane is Cl[SiH2]C(=Cc1ccccc1)c1ccccc1.
What is the InChIKey of chloro(1,2-diphenylethenyl)silane?
The InChIKey is XOBHUOJJJBZUQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClSi/c15-16-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-11H,16H2.
What are the key properties of chloro(1,2-diphenylethenyl)silane?
chloro(1,2-diphenylethenyl)silane has a molecular weight of 244.80 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(1,2-diphenylethenyl)silane is sourced from PubChem (CID 123632662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).