About (2-bromo-3-phenylbuta-1,3-dienyl)benzene
(2-bromo-3-phenylbuta-1,3-dienyl)benzene (PubChem CID 71411112) has the molecular formula C16H13Br
and a molecular weight of 285.18 g/mol. Its IUPAC name is (2-bromo-3-phenylbuta-1,3-dienyl)benzene.
Molecular Properties
| Compound Name | (2-bromo-3-phenylbuta-1,3-dienyl)benzene |
| PubChem CID | 71411112 |
| Molecular Formula | C16H13Br |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | (2-bromo-3-phenylbuta-1,3-dienyl)benzene |
| SMILES | C=C(C(Br)=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H13Br/c1-13(15-10-6-3-7-11-15)16(17)12-14-8-4-2-5-9-14/h2-12H,1H2 |
| InChIKey | XBWLVMCNOKNKPG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-3-phenylbuta-1,3-dienyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-3-phenylbuta-1,3-dienyl)benzene?
The IUPAC name of (2-bromo-3-phenylbuta-1,3-dienyl)benzene (CID 71411112) is (2-bromo-3-phenylbuta-1,3-dienyl)benzene.
What is the SMILES notation for (2-bromo-3-phenylbuta-1,3-dienyl)benzene?
The canonical SMILES for (2-bromo-3-phenylbuta-1,3-dienyl)benzene is C=C(C(Br)=Cc1ccccc1)c1ccccc1.
What is the InChIKey of (2-bromo-3-phenylbuta-1,3-dienyl)benzene?
The InChIKey is XBWLVMCNOKNKPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Br/c1-13(15-10-6-3-7-11-15)16(17)12-14-8-4-2-5-9-14/h2-12H,1H2.
What are the key properties of (2-bromo-3-phenylbuta-1,3-dienyl)benzene?
(2-bromo-3-phenylbuta-1,3-dienyl)benzene has a molecular weight of 285.18 g/mol, XLogP of 5.14, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-3-phenylbuta-1,3-dienyl)benzene is sourced from PubChem (CID 71411112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).