About 1-bromoethenylbenzene;sulfane
1-bromoethenylbenzene;sulfane (PubChem CID 175924538) has the molecular formula C8H9BrS
and a molecular weight of 217.13 g/mol. Its IUPAC name is 1-bromoethenylbenzene;sulfane.
Molecular Properties
| Compound Name | 1-bromoethenylbenzene;sulfane |
| PubChem CID | 175924538 |
| Molecular Formula | C8H9BrS |
| Molecular Weight | 217.13 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | 1-bromoethenylbenzene;sulfane |
| SMILES | C=C(Br)c1ccccc1.S |
| InChI | InChI=1S/C8H7Br.H2S/c1-7(9)8-5-3-2-4-6-8;/h2-6H,1H2;1H2 |
| InChIKey | LMPYNEHSKWDJGX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.13 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromoethenylbenzene;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoethenylbenzene;sulfane?
The IUPAC name of 1-bromoethenylbenzene;sulfane (CID 175924538) is 1-bromoethenylbenzene;sulfane.
What is the SMILES notation for 1-bromoethenylbenzene;sulfane?
The canonical SMILES for 1-bromoethenylbenzene;sulfane is C=C(Br)c1ccccc1.S.
What is the InChIKey of 1-bromoethenylbenzene;sulfane?
The InChIKey is LMPYNEHSKWDJGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br.H2S/c1-7(9)8-5-3-2-4-6-8;/h2-6H,1H2;1H2.
What are the key properties of 1-bromoethenylbenzene;sulfane?
1-bromoethenylbenzene;sulfane has a molecular weight of 217.13 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoethenylbenzene;sulfane is sourced from PubChem (CID 175924538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).