C18H23N — CID 126661353
(E)-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-3-(2-methylphenyl)pent-3-en-2-imine (PubChem CID 126661353) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is (E)-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-3-(2-methylphenyl)pent-3-en-2-imine.
| Compound Name | (E)-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-3-(2-methylphenyl)pent-3-en-2-imine |
|---|---|
| PubChem CID | 126661353 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (E)-N-[(3Z)-2-methylpenta-1,3-dien-3-yl]-3-(2-methylphenyl)pent-3-en-2-imine |
| SMILES | C=C(C)C(=C/C)/N=C(C)\C(=C\C)c1ccccc1C |
| InChI | InChI=1S/C18H23N/c1-7-16(17-12-10-9-11-14(17)5)15(6)19-18(8-2)13(3)4/h7-12H,3H2,1-2,4-6H3/b16-7-,18-8-,19-15+ |
| InChIKey | DTHCEIRJKVYBKJ-GPTRJDBWSA-N |
| XLogP | 5.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|