C20H29NO — CID 145056542
(E,E)-N-[(3S)-3-methylhept-1-en-2-yl]oxy-3-(2-methylphenyl)pent-3-en-2-imine (PubChem CID 145056542) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (E,E)-N-[(3S)-3-methylhept-1-en-2-yl]oxy-3-(2-methylphenyl)pent-3-en-2-imine.
| Compound Name | (E,E)-N-[(3S)-3-methylhept-1-en-2-yl]oxy-3-(2-methylphenyl)pent-3-en-2-imine |
|---|---|
| PubChem CID | 145056542 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (E,E)-N-[(3S)-3-methylhept-1-en-2-yl]oxy-3-(2-methylphenyl)pent-3-en-2-imine |
| SMILES | C=C(O/N=C(C)/C(=C/C)c1ccccc1C)[C@@H](C)CCCC |
| InChI | InChI=1S/C20H29NO/c1-7-9-12-15(3)18(6)22-21-17(5)19(8-2)20-14-11-10-13-16(20)4/h8,10-11,13-15H,6-7,9,12H2,1-5H3/b19-8-,21-17+/t15-/m0/s1 |
| InChIKey | ZZMIASTZSVEYRP-IOYSJBNLSA-N |
| XLogP | 6.13 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|