About butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene
butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene (PubChem CID 143336788) has the molecular formula C24H42O
and a molecular weight of 346.60 g/mol. Its IUPAC name is butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene.
Molecular Properties
| Compound Name | butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene |
| PubChem CID | 143336788 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene |
| SMILES | CC(C)=C(C)c1ccccc1C.CCC(C)=O.CCCCCC(C)C |
| InChI | InChI=1S/C12H16.C8H18.C4H8O/c1-9(2)11(4)12-8-6-5-7-10(12)3;1-4-5-6-7-8(2)3;1-3-4(2)5/h5-8H,1-4H3;8H,4-7H2,1-3H3;3H2,1-2H3 |
| InChIKey | JGZMGTKSDCNYAR-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene?
The IUPAC name of butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene (CID 143336788) is butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene.
What is the SMILES notation for butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene?
The canonical SMILES for butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene is CC(C)=C(C)c1ccccc1C.CCC(C)=O.CCCCCC(C)C.
What is the InChIKey of butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene?
The InChIKey is JGZMGTKSDCNYAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C8H18.C4H8O/c1-9(2)11(4)12-8-6-5-7-10(12)3;1-4-5-6-7-8(2)3;1-3-4(2)5/h5-8H,1-4H3;8H,4-7H2,1-3H3;3H2,1-2H3.
What are the key properties of butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene?
butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene has a molecular weight of 346.60 g/mol, XLogP of 8.02, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;2-methylheptane;1-methyl-2-(3-methylbut-2-en-2-yl)benzene is sourced from PubChem (CID 143336788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).