C27H44N4O — CID 145056767
ethanimidamide;(E)-1-(1-heptylindol-4-yl)-N-[(3S)-3-methylhept-1-en-2-yl]oxyethanimine (PubChem CID 145056767) has the molecular formula C27H44N4O and a molecular weight of 440.68 g/mol. Its IUPAC name is ethanimidamide;(E)-1-(1-heptylindol-4-yl)-N-[(3S)-3-methylhept-1-en-2-yl]oxyethanimine.
| Compound Name | ethanimidamide;(E)-1-(1-heptylindol-4-yl)-N-[(3S)-3-methylhept-1-en-2-yl]oxyethanimine |
|---|---|
| PubChem CID | 145056767 |
| Molecular Formula | C27H44N4O |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | ethanimidamide;(E)-1-(1-heptylindol-4-yl)-N-[(3S)-3-methylhept-1-en-2-yl]oxyethanimine |
| SMILES | C=C(O/N=C(\C)c1cccc2c1ccn2CCCCCCC)[C@@H](C)CCCC.[H]/N=C(\C)N |
| InChI | InChI=1S/C25H38N2O.C2H6N2/c1-6-8-10-11-12-18-27-19-17-24-23(15-13-16-25(24)27)21(4)26-28-22(5)20(3)14-9-7-2;1-2(3)4/h13,15-17,19-20H,5-12,14,18H2,1-4H3;1H3,(H3,3,4)/b26-21+;/t20-;/m0./s1 |
| InChIKey | USGYGDCPHKSWIC-YPVCEGRXSA-N |
| XLogP | 7.63 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|