C14H17N — CID 178203194
1-butyl-4-ethenylindole (PubChem CID 178203194) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-butyl-4-ethenylindole.
| Compound Name | 1-butyl-4-ethenylindole |
|---|---|
| PubChem CID | 178203194 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 1-butyl-4-ethenylindole |
| SMILES | C=Cc1cccc2c1ccn2CCCC |
| InChI | InChI=1S/C14H17N/c1-3-5-10-15-11-9-13-12(4-2)7-6-8-14(13)15/h4,6-9,11H,2-3,5,10H2,1H3 |
| InChIKey | UBIBOSFAHBODJD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |