C15H23NO2 — CID 134275721
(1E,2S)-1-methoxyimino-1-(2-methylphenyl)heptan-2-ol (PubChem CID 134275721) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (1E,2S)-1-methoxyimino-1-(2-methylphenyl)heptan-2-ol.
| Compound Name | (1E,2S)-1-methoxyimino-1-(2-methylphenyl)heptan-2-ol |
|---|---|
| PubChem CID | 134275721 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (1E,2S)-1-methoxyimino-1-(2-methylphenyl)heptan-2-ol |
| SMILES | CCCCC[C@H](O)/C(=N/OC)c1ccccc1C |
| InChI | InChI=1S/C15H23NO2/c1-4-5-6-11-14(17)15(16-18-3)13-10-8-7-9-12(13)2/h7-10,14,17H,4-6,11H2,1-3H3/b16-15+/t14-/m0/s1 |
| InChIKey | IXQXEPIDEFHMBO-BSZDNMLHSA-N |
| XLogP | 3.29 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|