C28H26O — CID 145465219
1-[4-[4-[(3Z)-5-methyl-4-(2-methylphenyl)hexa-1,3,5-trien-2-yl]phenyl]phenyl]ethanone (PubChem CID 145465219) has the molecular formula C28H26O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-[4-[4-[(3Z)-5-methyl-4-(2-methylphenyl)hexa-1,3,5-trien-2-yl]phenyl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[(3Z)-5-methyl-4-(2-methylphenyl)hexa-1,3,5-trien-2-yl]phenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 145465219 |
| Molecular Formula | C28H26O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 1-[4-[4-[(3Z)-5-methyl-4-(2-methylphenyl)hexa-1,3,5-trien-2-yl]phenyl]phenyl]ethanone |
| SMILES | C=C(C)/C(=C/C(=C)c1ccc(-c2ccc(C(C)=O)cc2)cc1)c1ccccc1C |
| InChI | InChI=1S/C28H26O/c1-19(2)28(27-9-7-6-8-20(27)3)18-21(4)23-10-14-25(15-11-23)26-16-12-24(13-17-26)22(5)29/h6-18H,1,4H2,2-3,5H3/b28-18- |
| InChIKey | XMGKGPYRRANYMJ-VEILYXNESA-N |
| XLogP | 7.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|