C27H26O — CID 145465308
6-[4-[(3Z)-4-(2-methylphenyl)penta-1,3-dien-2-yl]phenyl]-3,4-dihydro-2H-chromene (PubChem CID 145465308) has the molecular formula C27H26O and a molecular weight of 366.50 g/mol. Its IUPAC name is 6-[4-[(3Z)-4-(2-methylphenyl)penta-1,3-dien-2-yl]phenyl]-3,4-dihydro-2H-chromene.
| Compound Name | 6-[4-[(3Z)-4-(2-methylphenyl)penta-1,3-dien-2-yl]phenyl]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 145465308 |
| Molecular Formula | C27H26O |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 6-[4-[(3Z)-4-(2-methylphenyl)penta-1,3-dien-2-yl]phenyl]-3,4-dihydro-2H-chromene |
| SMILES | C=C(/C=C(/C)c1ccccc1C)c1ccc(-c2ccc3c(c2)CCCO3)cc1 |
| InChI | InChI=1S/C27H26O/c1-19-7-4-5-9-26(19)21(3)17-20(2)22-10-12-23(13-11-22)24-14-15-27-25(18-24)8-6-16-28-27/h4-5,7,9-15,17-18H,2,6,8,16H2,1,3H3/b21-17- |
| InChIKey | CAFYPIMGDSAMRD-FXBPSFAMSA-N |
| XLogP | 7.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|