C20H24O — CID 126760659
6-(4-pentan-3-ylphenyl)-3,4-dihydro-2H-chromene (PubChem CID 126760659) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is 6-(4-pentan-3-ylphenyl)-3,4-dihydro-2H-chromene.
| Compound Name | 6-(4-pentan-3-ylphenyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 126760659 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 6-(4-pentan-3-ylphenyl)-3,4-dihydro-2H-chromene |
| SMILES | CCC(CC)c1ccc(-c2ccc3c(c2)CCCO3)cc1 |
| InChI | InChI=1S/C20H24O/c1-3-15(4-2)16-7-9-17(10-8-16)18-11-12-20-19(14-18)6-5-13-21-20/h7-12,14-15H,3-6,13H2,1-2H3 |
| InChIKey | WCGUHVBUNNUJOU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |