C20H20O4 — CID 88570224
(2E)-4-(3,4-dimethoxyphenyl)-2-(2-methylphenyl)penta-2,4-dienoic acid (PubChem CID 88570224) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2E)-4-(3,4-dimethoxyphenyl)-2-(2-methylphenyl)penta-2,4-dienoic acid.
| Compound Name | (2E)-4-(3,4-dimethoxyphenyl)-2-(2-methylphenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 88570224 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (2E)-4-(3,4-dimethoxyphenyl)-2-(2-methylphenyl)penta-2,4-dienoic acid |
| SMILES | C=C(/C=C(/C(=O)O)c1ccccc1C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H20O4/c1-13-7-5-6-8-16(13)17(20(21)22)11-14(2)15-9-10-18(23-3)19(12-15)24-4/h5-12H,2H2,1,3-4H3,(H,21,22)/b17-11+ |
| InChIKey | OTNXIXNKJZRBAJ-GZTJUZNOSA-N |
| XLogP | 4.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|