C13H13ClO2 — CID 89174791
methyl (2E)-4-chloro-2-(2-methylphenyl)penta-2,4-dienoate (PubChem CID 89174791) has the molecular formula C13H13ClO2 and a molecular weight of 236.70 g/mol. Its IUPAC name is methyl (2E)-4-chloro-2-(2-methylphenyl)penta-2,4-dienoate.
| Compound Name | methyl (2E)-4-chloro-2-(2-methylphenyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 89174791 |
| Molecular Formula | C13H13ClO2 |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | methyl (2E)-4-chloro-2-(2-methylphenyl)penta-2,4-dienoate |
| SMILES | C=C(Cl)/C=C(/C(=O)OC)c1ccccc1C |
| InChI | InChI=1S/C13H13ClO2/c1-9-6-4-5-7-11(9)12(8-10(2)14)13(15)16-3/h4-8H,2H2,1,3H3/b12-8+ |
| InChIKey | AFVASKJWNQVCAL-XYOKQWHBSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|