C15H17ClO2 — CID 143058962
methyl (2E,4Z)-4-chloro-2-(2-methylphenyl)hepta-2,4-dienoate (PubChem CID 143058962) has the molecular formula C15H17ClO2 and a molecular weight of 264.75 g/mol. Its IUPAC name is methyl (2E,4Z)-4-chloro-2-(2-methylphenyl)hepta-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-4-chloro-2-(2-methylphenyl)hepta-2,4-dienoate |
|---|---|
| PubChem CID | 143058962 |
| Molecular Formula | C15H17ClO2 |
| Molecular Weight | 264.75 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | methyl (2E,4Z)-4-chloro-2-(2-methylphenyl)hepta-2,4-dienoate |
| SMILES | CC/C=C(Cl)/C=C(/C(=O)OC)c1ccccc1C |
| InChI | InChI=1S/C15H17ClO2/c1-4-7-12(16)10-14(15(17)18-3)13-9-6-5-8-11(13)2/h5-10H,4H2,1-3H3/b12-7-,14-10+ |
| InChIKey | HAEOLFWQVUOXAD-BAWRXQRJSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.75 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|