C14H16ClNO — CID 89179677
(2E)-4-chloro-N,N-dimethyl-2-(2-methylphenyl)penta-2,4-dienamide (PubChem CID 89179677) has the molecular formula C14H16ClNO and a molecular weight of 249.74 g/mol. Its IUPAC name is (2E)-4-chloro-N,N-dimethyl-2-(2-methylphenyl)penta-2,4-dienamide.
| Compound Name | (2E)-4-chloro-N,N-dimethyl-2-(2-methylphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 89179677 |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (2E)-4-chloro-N,N-dimethyl-2-(2-methylphenyl)penta-2,4-dienamide |
| SMILES | C=C(Cl)/C=C(/C(=O)N(C)C)c1ccccc1C |
| InChI | InChI=1S/C14H16ClNO/c1-10-7-5-6-8-12(10)13(9-11(2)15)14(17)16(3)4/h5-9H,2H2,1,3-4H3/b13-9+ |
| InChIKey | ARARTNRRNUYQPN-UKTHLTGXSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|