C18H20 — CID 143924136
1-[(3Z,5E)-5-ethenyl-2-methylocta-1,3,5,7-tetraen-4-yl]-2-methylbenzene (PubChem CID 143924136) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-[(3Z,5E)-5-ethenyl-2-methylocta-1,3,5,7-tetraen-4-yl]-2-methylbenzene.
| Compound Name | 1-[(3Z,5E)-5-ethenyl-2-methylocta-1,3,5,7-tetraen-4-yl]-2-methylbenzene |
|---|---|
| PubChem CID | 143924136 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-[(3Z,5E)-5-ethenyl-2-methylocta-1,3,5,7-tetraen-4-yl]-2-methylbenzene |
| SMILES | C=C/C=C(C=C)/C(=C/C(=C)C)c1ccccc1C |
| InChI | InChI=1S/C18H20/c1-6-10-16(7-2)18(13-14(3)4)17-12-9-8-11-15(17)5/h6-13H,1-3H2,4-5H3/b16-10+,18-13- |
| InChIKey | MCEPFCLEHRVFQX-FHKCCDTASA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|