C11H12O3S — CID 154979456
(1E)-1-(2-methylphenyl)buta-1,3-diene-1-sulfonic acid (PubChem CID 154979456) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is (1E)-1-(2-methylphenyl)buta-1,3-diene-1-sulfonic acid.
| Compound Name | (1E)-1-(2-methylphenyl)buta-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 154979456 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | (1E)-1-(2-methylphenyl)buta-1,3-diene-1-sulfonic acid |
| SMILES | C=C/C=C(\c1ccccc1C)S(=O)(=O)O |
| InChI | InChI=1S/C11H12O3S/c1-3-6-11(15(12,13)14)10-8-5-4-7-9(10)2/h3-8H,1H2,2H3,(H,12,13,14)/b11-6+ |
| InChIKey | FWTDLDVSPWXTFC-IZZDOVSWSA-N |
| XLogP | 2.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|