C23H28O3 — CID 143845030
1-(3,4-dimethoxyphenyl)ethanone;1-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-methylbenzene (PubChem CID 143845030) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)ethanone;1-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-methylbenzene.
| Compound Name | 1-(3,4-dimethoxyphenyl)ethanone;1-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-methylbenzene |
|---|---|
| PubChem CID | 143845030 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)ethanone;1-[(2E,4Z)-hexa-2,4-dien-2-yl]-2-methylbenzene |
| SMILES | C/C=C\C=C(/C)c1ccccc1C.COc1ccc(C(C)=O)cc1OC |
| InChI | InChI=1S/C13H16.C10H12O3/c1-4-5-8-11(2)13-10-7-6-9-12(13)3;1-7(11)8-4-5-9(12-2)10(6-8)13-3/h4-10H,1-3H3;4-6H,1-3H3/b5-4-,11-8+; |
| InChIKey | JETLQBRQULVWQV-ZENMCMQFSA-N |
| XLogP | 5.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|