C29H39Br2N — CID 143096728
N-[(2Z,4E,6Z,10E,12E)-11,13-dibromo-5-methyl-8,9-dimethylidenetetradeca-2,4,6,10,12-pentaen-6-yl]-1-phenylethanimine;ethane (PubChem CID 143096728) has the molecular formula C29H39Br2N and a molecular weight of 561.45 g/mol. Its IUPAC name is N-[(2Z,4E,6Z,10E,12E)-11,13-dibromo-5-methyl-8,9-dimethylidenetetradeca-2,4,6,10,12-pentaen-6-yl]-1-phenylethanimine;ethane.
| Compound Name | N-[(2Z,4E,6Z,10E,12E)-11,13-dibromo-5-methyl-8,9-dimethylidenetetradeca-2,4,6,10,12-pentaen-6-yl]-1-phenylethanimine;ethane |
|---|---|
| PubChem CID | 143096728 |
| Molecular Formula | C29H39Br2N |
| Molecular Weight | 561.45 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | N-[(2Z,4E,6Z,10E,12E)-11,13-dibromo-5-methyl-8,9-dimethylidenetetradeca-2,4,6,10,12-pentaen-6-yl]-1-phenylethanimine;ethane |
| SMILES | C=C(/C=C(\N=C(/C)c1ccccc1)C(/C)=C/C=C\C)C(=C)/C=C(Br)\C=C(/C)Br.CC.CC |
| InChI | InChI=1S/C25H27Br2N.2C2H6/c1-7-8-12-18(2)25(28-22(6)23-13-10-9-11-14-23)16-20(4)19(3)15-24(27)17-21(5)26;2*1-2/h7-17H,3-4H2,1-2,5-6H3;2*1-2H3/b8-7-,18-12+,21-17+,24-15+,25-16-,28-22+;; |
| InChIKey | LRDUUWXGURNFDN-UNFFFEKSSA-N |
| XLogP | 10.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.45 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|