C16H17NO2 — CID 138565048
(1-phenylethylideneamino) (2E,4Z)-2-ethenylhexa-2,4-dienoate (PubChem CID 138565048) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (1-phenylethylideneamino) (2E,4Z)-2-ethenylhexa-2,4-dienoate.
| Compound Name | (1-phenylethylideneamino) (2E,4Z)-2-ethenylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 138565048 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (1-phenylethylideneamino) (2E,4Z)-2-ethenylhexa-2,4-dienoate |
| SMILES | C=C/C(=C\C=C/C)C(=O)ON=C(C)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c1-4-6-10-14(5-2)16(18)19-17-13(3)15-11-8-7-9-12-15/h4-12H,2H2,1,3H3/b6-4-,14-10+,17-13? |
| InChIKey | DZWDYBRBGFFYOC-ZMSOKUAISA-N |
| XLogP | 3.64 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|