C17H14N2 — CID 142275586
(E)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-phenylbut-2-enedinitrile (PubChem CID 142275586) has the molecular formula C17H14N2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (E)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-phenylbut-2-enedinitrile.
| Compound Name | (E)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-phenylbut-2-enedinitrile |
|---|---|
| PubChem CID | 142275586 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (E)-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-phenylbut-2-enedinitrile |
| SMILES | C=CC(=C\C=C/C)/C(C#N)=C(\C#N)c1ccccc1 |
| InChI | InChI=1S/C17H14N2/c1-3-5-9-14(4-2)16(12-18)17(13-19)15-10-7-6-8-11-15/h3-11H,2H2,1H3/b5-3-,14-9+,17-16+ |
| InChIKey | ZPJKYFAWGUWQER-FFPDXBAOSA-N |
| XLogP | 4.18 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|