C15H17N — CID 129227645
(2E,4Z)-2-ethenyl-N-methyl-1-phenylhexa-2,4-dien-1-imine (PubChem CID 129227645) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-N-methyl-1-phenylhexa-2,4-dien-1-imine.
| Compound Name | (2E,4Z)-2-ethenyl-N-methyl-1-phenylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 129227645 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (2E,4Z)-2-ethenyl-N-methyl-1-phenylhexa-2,4-dien-1-imine |
| SMILES | C=CC(=C\C=C/C)/C(=N/C)c1ccccc1 |
| InChI | InChI=1S/C15H17N/c1-4-6-10-13(5-2)15(16-3)14-11-8-7-9-12-14/h4-12H,2H2,1,3H3/b6-4-,13-10+,16-15- |
| InChIKey | AWVGHMIFRPIDDD-GEXJTDPESA-N |
| XLogP | 3.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|