C17H22O2 — CID 144955249
(4-ethylphenyl) (2E,4Z)-2-ethenylhexa-2,4-dienoate;methane (PubChem CID 144955249) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (4-ethylphenyl) (2E,4Z)-2-ethenylhexa-2,4-dienoate;methane.
| Compound Name | (4-ethylphenyl) (2E,4Z)-2-ethenylhexa-2,4-dienoate;methane |
|---|---|
| PubChem CID | 144955249 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (4-ethylphenyl) (2E,4Z)-2-ethenylhexa-2,4-dienoate;methane |
| SMILES | C.C=C/C(=C\C=C/C)C(=O)Oc1ccc(CC)cc1 |
| InChI | InChI=1S/C16H18O2.CH4/c1-4-7-8-14(6-3)16(17)18-15-11-9-13(5-2)10-12-15;/h4,6-12H,3,5H2,1-2H3;1H4/b7-4-,14-8+; |
| InChIKey | NWGZNFZEJPVGOY-WEDCHJHJSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|