About (4-ethylphenyl) 2-(bromomethyl)but-2-enoate
(4-ethylphenyl) 2-(bromomethyl)but-2-enoate (PubChem CID 71373207) has the molecular formula C13H15BrO2
and a molecular weight of 283.16 g/mol. Its IUPAC name is (4-ethylphenyl) 2-(bromomethyl)but-2-enoate.
Molecular Properties
| Compound Name | (4-ethylphenyl) 2-(bromomethyl)but-2-enoate |
| PubChem CID | 71373207 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (4-ethylphenyl) 2-(bromomethyl)but-2-enoate |
| SMILES | CC=C(CBr)C(=O)Oc1ccc(CC)cc1 |
| InChI | InChI=1S/C13H15BrO2/c1-3-10-5-7-12(8-6-10)16-13(15)11(4-2)9-14/h4-8H,3,9H2,1-2H3 |
| InChIKey | FZXGJFJYVSRPBK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylphenyl) 2-(bromomethyl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl) 2-(bromomethyl)but-2-enoate?
The IUPAC name of (4-ethylphenyl) 2-(bromomethyl)but-2-enoate (CID 71373207) is (4-ethylphenyl) 2-(bromomethyl)but-2-enoate.
What is the SMILES notation for (4-ethylphenyl) 2-(bromomethyl)but-2-enoate?
The canonical SMILES for (4-ethylphenyl) 2-(bromomethyl)but-2-enoate is CC=C(CBr)C(=O)Oc1ccc(CC)cc1.
What is the InChIKey of (4-ethylphenyl) 2-(bromomethyl)but-2-enoate?
The InChIKey is FZXGJFJYVSRPBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrO2/c1-3-10-5-7-12(8-6-10)16-13(15)11(4-2)9-14/h4-8H,3,9H2,1-2H3.
What are the key properties of (4-ethylphenyl) 2-(bromomethyl)but-2-enoate?
(4-ethylphenyl) 2-(bromomethyl)but-2-enoate has a molecular weight of 283.16 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl) 2-(bromomethyl)but-2-enoate is sourced from PubChem (CID 71373207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).