C28H34O2Sn — CID 173416836
(4-ethylphenyl) 3,3-bis(4-ethylphenyl)-2-methylprop-2-enoate;stannane (PubChem CID 173416836) has the molecular formula C28H34O2Sn and a molecular weight of 521.29 g/mol. Its IUPAC name is (4-ethylphenyl) 3,3-bis(4-ethylphenyl)-2-methylprop-2-enoate;stannane.
| Compound Name | (4-ethylphenyl) 3,3-bis(4-ethylphenyl)-2-methylprop-2-enoate;stannane |
|---|---|
| PubChem CID | 173416836 |
| Molecular Formula | C28H34O2Sn |
| Molecular Weight | 521.29 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | (4-ethylphenyl) 3,3-bis(4-ethylphenyl)-2-methylprop-2-enoate;stannane |
| SMILES | CCc1ccc(OC(=O)C(C)=C(c2ccc(CC)cc2)c2ccc(CC)cc2)cc1.[SnH4] |
| InChI | InChI=1S/C28H30O2.Sn.4H/c1-5-21-8-14-24(15-9-21)27(25-16-10-22(6-2)11-17-25)20(4)28(29)30-26-18-12-23(7-3)13-19-26;;;;;/h8-19H,5-7H2,1-4H3;;;;; |
| InChIKey | WLTBSXSFXVBACW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.29 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|