C19H18O5 — CID 145318534
2-O-[(3E,5Z)-hepta-3,5-dien-3-yl] 5-O-phenyl furan-2,5-dicarboxylate (PubChem CID 145318534) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-O-[(3E,5Z)-hepta-3,5-dien-3-yl] 5-O-phenyl furan-2,5-dicarboxylate.
| Compound Name | 2-O-[(3E,5Z)-hepta-3,5-dien-3-yl] 5-O-phenyl furan-2,5-dicarboxylate |
|---|---|
| PubChem CID | 145318534 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-O-[(3E,5Z)-hepta-3,5-dien-3-yl] 5-O-phenyl furan-2,5-dicarboxylate |
| SMILES | C/C=C\C=C(/CC)OC(=O)c1ccc(C(=O)Oc2ccccc2)o1 |
| InChI | InChI=1S/C19H18O5/c1-3-5-9-14(4-2)22-18(20)16-12-13-17(24-16)19(21)23-15-10-7-6-8-11-15/h3,5-13H,4H2,1-2H3/b5-3-,14-9+ |
| InChIKey | LAGOQLKFELNXNS-NUHYDXFESA-N |
| XLogP | 4.53 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|