About 1-oxopent-2-en-3-yl benzoate
1-oxopent-2-en-3-yl benzoate (PubChem CID 175289286) has the molecular formula C12H12O3
and a molecular weight of 204.23 g/mol. Its IUPAC name is 1-oxopent-2-en-3-yl benzoate.
Molecular Properties
| Compound Name | 1-oxopent-2-en-3-yl benzoate |
| PubChem CID | 175289286 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 1-oxopent-2-en-3-yl benzoate |
| SMILES | CCC(=CC=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O3/c1-2-11(8-9-13)15-12(14)10-6-4-3-5-7-10/h3-9H,2H2,1H3 |
| InChIKey | XLRHCVOUYBVZAH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-oxopent-2-en-3-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxopent-2-en-3-yl benzoate?
The IUPAC name of 1-oxopent-2-en-3-yl benzoate (CID 175289286) is 1-oxopent-2-en-3-yl benzoate.
What is the SMILES notation for 1-oxopent-2-en-3-yl benzoate?
The canonical SMILES for 1-oxopent-2-en-3-yl benzoate is CCC(=CC=O)OC(=O)c1ccccc1.
What is the InChIKey of 1-oxopent-2-en-3-yl benzoate?
The InChIKey is XLRHCVOUYBVZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c1-2-11(8-9-13)15-12(14)10-6-4-3-5-7-10/h3-9H,2H2,1H3.
What are the key properties of 1-oxopent-2-en-3-yl benzoate?
1-oxopent-2-en-3-yl benzoate has a molecular weight of 204.23 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxopent-2-en-3-yl benzoate is sourced from PubChem (CID 175289286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).