About CID 58750532
CID 58750532 (PubChem CID 58750532) has the molecular formula C23H21O2
and a molecular weight of 329.42 g/mol.
Molecular Properties
| Compound Name | CID 58750532 |
| PubChem CID | 58750532 |
| Molecular Formula | C23H21O2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | — |
| SMILES | CC[C](OC(=O)c1ccc(-c2ccc(C)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H21O2/c1-3-22(20-7-5-4-6-8-20)25-23(24)21-15-13-19(14-16-21)18-11-9-17(2)10-12-18/h4-16H,3H2,1-2H3 |
| InChIKey | RNKBYGMEUWFRRM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 58750532 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58750532?
The IUPAC name of CID 58750532 (CID 58750532) is not available.
What is the SMILES notation for CID 58750532?
The canonical SMILES for CID 58750532 is CC[C](OC(=O)c1ccc(-c2ccc(C)cc2)cc1)c1ccccc1.
What is the InChIKey of CID 58750532?
The InChIKey is RNKBYGMEUWFRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21O2/c1-3-22(20-7-5-4-6-8-20)25-23(24)21-15-13-19(14-16-21)18-11-9-17(2)10-12-18/h4-16H,3H2,1-2H3.
What are the key properties of CID 58750532?
CID 58750532 has a molecular weight of 329.42 g/mol, XLogP of 5.81, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58750532 is sourced from PubChem (CID 58750532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).