C54H42N2 — CID 144939324
N'-[1-[7-(9,9-dimethylfluoren-4-yl)naphthalen-2-yl]ethenyl]-3-phenyl-N-[1-(3-phenylphenyl)ethylidene]benzenecarboximidamide (PubChem CID 144939324) has the molecular formula C54H42N2 and a molecular weight of 718.94 g/mol. Its IUPAC name is N'-[1-[7-(9,9-dimethylfluoren-4-yl)naphthalen-2-yl]ethenyl]-3-phenyl-N-[1-(3-phenylphenyl)ethylidene]benzenecarboximidamide.
| Compound Name | N'-[1-[7-(9,9-dimethylfluoren-4-yl)naphthalen-2-yl]ethenyl]-3-phenyl-N-[1-(3-phenylphenyl)ethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 144939324 |
| Molecular Formula | C54H42N2 |
| Molecular Weight | 718.94 g/mol |
| Exact Mass | 718.33 |
| IUPAC Name | N'-[1-[7-(9,9-dimethylfluoren-4-yl)naphthalen-2-yl]ethenyl]-3-phenyl-N-[1-(3-phenylphenyl)ethylidene]benzenecarboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1cccc(-c2ccccc2)c1)c1cccc(-c2ccccc2)c1)c1ccc2ccc(-c3cccc4c3-c3ccccc3C4(C)C)cc2c1 |
| InChI | InChI=1S/C54H42N2/c1-36(41-20-13-21-43(32-41)38-16-7-5-8-17-38)55-53(46-23-14-22-44(34-46)39-18-9-6-10-19-39)56-37(2)42-30-28-40-29-31-45(35-47(40)33-42)48-25-15-27-51-52(48)49-24-11-12-26-50(49)54(51,3)4/h5-35H,2H2,1,3-4H3/b55-36+,56-53- |
| InChIKey | JXHYMDZLPMENLS-CQXOKHAPSA-N |
| XLogP | 14.07 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.94 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|