C50H38N2 — CID 144939296
7-(9,9-dimethylfluoren-2-yl)-N'-(1-naphthalen-1-ylethenyl)-N-(1-naphthalen-1-ylethylidene)naphthalene-2-carboximidamide (PubChem CID 144939296) has the molecular formula C50H38N2 and a molecular weight of 666.87 g/mol. Its IUPAC name is 7-(9,9-dimethylfluoren-2-yl)-N'-(1-naphthalen-1-ylethenyl)-N-(1-naphthalen-1-ylethylidene)naphthalene-2-carboximidamide.
| Compound Name | 7-(9,9-dimethylfluoren-2-yl)-N'-(1-naphthalen-1-ylethenyl)-N-(1-naphthalen-1-ylethylidene)naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 144939296 |
| Molecular Formula | C50H38N2 |
| Molecular Weight | 666.87 g/mol |
| Exact Mass | 666.30 |
| IUPAC Name | 7-(9,9-dimethylfluoren-2-yl)-N'-(1-naphthalen-1-ylethenyl)-N-(1-naphthalen-1-ylethylidene)naphthalene-2-carboximidamide |
| SMILES | C=C(/N=C(\N=C(/C)c1cccc2ccccc12)c1ccc2ccc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C50H38N2/c1-32(41-20-11-15-35-13-5-7-17-43(35)41)51-49(52-33(2)42-21-12-16-36-14-6-8-18-44(36)42)39-26-24-34-23-25-37(29-40(34)30-39)38-27-28-46-45-19-9-10-22-47(45)50(3,4)48(46)31-38/h5-31H,1H2,2-4H3/b51-49-,52-33+ |
| InChIKey | FXVXDAYBYAXTJN-DIKNEJSRSA-N |
| XLogP | 13.05 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.87 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|