About 3-methylpenta-3,4-dien-1-ynylbenzene
3-methylpenta-3,4-dien-1-ynylbenzene (PubChem CID 11182723) has the molecular formula C12H10
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-methylpenta-3,4-dien-1-ynylbenzene.
Molecular Properties
| Compound Name | 3-methylpenta-3,4-dien-1-ynylbenzene |
| PubChem CID | 11182723 |
| Molecular Formula | C12H10 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 3-methylpenta-3,4-dien-1-ynylbenzene |
| SMILES | C=C=C(C)C#Cc1ccccc1 |
| InChI | InChI=1S/C12H10/c1-3-11(2)9-10-12-7-5-4-6-8-12/h4-8H,1H2,2H3 |
| InChIKey | GADJZGKGFGMBMJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpenta-3,4-dien-1-ynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpenta-3,4-dien-1-ynylbenzene?
The IUPAC name of 3-methylpenta-3,4-dien-1-ynylbenzene (CID 11182723) is 3-methylpenta-3,4-dien-1-ynylbenzene.
What is the SMILES notation for 3-methylpenta-3,4-dien-1-ynylbenzene?
The canonical SMILES for 3-methylpenta-3,4-dien-1-ynylbenzene is C=C=C(C)C#Cc1ccccc1.
What is the InChIKey of 3-methylpenta-3,4-dien-1-ynylbenzene?
The InChIKey is GADJZGKGFGMBMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10/c1-3-11(2)9-10-12-7-5-4-6-8-12/h4-8H,1H2,2H3.
What are the key properties of 3-methylpenta-3,4-dien-1-ynylbenzene?
3-methylpenta-3,4-dien-1-ynylbenzene has a molecular weight of 154.21 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpenta-3,4-dien-1-ynylbenzene is sourced from PubChem (CID 11182723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).