C12H10 — CID 11182723
3-methylpenta-3,4-dien-1-ynylbenzene (PubChem CID 11182723) has the molecular formula C12H10 and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-methylpenta-3,4-dien-1-ynylbenzene.
| Compound Name | 3-methylpenta-3,4-dien-1-ynylbenzene |
|---|---|
| PubChem CID | 11182723 |
| Molecular Formula | C12H10 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 3-methylpenta-3,4-dien-1-ynylbenzene |
| SMILES | C=C=C(C)C#Cc1ccccc1 |
| InChI | InChI=1S/C12H10/c1-3-11(2)9-10-12-7-5-4-6-8-12/h4-8H,1H2,2H3 |
| InChIKey | GADJZGKGFGMBMJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|