C17H18Si — CID 123432964
3-methylbuta-1,3-dienyl(diphenyl)silane (PubChem CID 123432964) has the molecular formula C17H18Si and a molecular weight of 250.42 g/mol. Its IUPAC name is 3-methylbuta-1,3-dienyl(diphenyl)silane.
| Compound Name | 3-methylbuta-1,3-dienyl(diphenyl)silane |
|---|---|
| PubChem CID | 123432964 |
| Molecular Formula | C17H18Si |
| Molecular Weight | 250.42 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 3-methylbuta-1,3-dienyl(diphenyl)silane |
| SMILES | C=C(C)C=C[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18Si/c1-15(2)13-14-18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-14,18H,1H2,2H3 |
| InChIKey | VZORDBCYNXFBOM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|