C15H19N — CID 143769400
(3Z)-5-methyl-N-(1-phenylethyl)hexa-1,3,5-trien-2-amine (PubChem CID 143769400) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is (3Z)-5-methyl-N-(1-phenylethyl)hexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-5-methyl-N-(1-phenylethyl)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143769400 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (3Z)-5-methyl-N-(1-phenylethyl)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C=C\C(=C)NC(C)c1ccccc1 |
| InChI | InChI=1S/C15H19N/c1-12(2)10-11-13(3)16-14(4)15-8-6-5-7-9-15/h5-11,14,16H,1,3H2,2,4H3/b11-10- |
| InChIKey | IHRQKJVCWNDLDZ-KHPPLWFESA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|