C16H15P — CID 23270104
buta-2,3-dien-2-yl(diphenyl)phosphane (PubChem CID 23270104) has the molecular formula C16H15P and a molecular weight of 238.27 g/mol. Its IUPAC name is buta-2,3-dien-2-yl(diphenyl)phosphane.
| Compound Name | buta-2,3-dien-2-yl(diphenyl)phosphane |
|---|---|
| PubChem CID | 23270104 |
| Molecular Formula | C16H15P |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | buta-2,3-dien-2-yl(diphenyl)phosphane |
| SMILES | C=C=C(C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15P/c1-3-14(2)17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,1H2,2H3 |
| InChIKey | PKGCJBCFJOGUOP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|