C27H25NOSi2 — CID 154318174
3,3-bis(diphenylsilyl)prop-2-enamide (PubChem CID 154318174) has the molecular formula C27H25NOSi2 and a molecular weight of 435.68 g/mol. Its IUPAC name is 3,3-bis(diphenylsilyl)prop-2-enamide.
| Compound Name | 3,3-bis(diphenylsilyl)prop-2-enamide |
|---|---|
| PubChem CID | 154318174 |
| Molecular Formula | C27H25NOSi2 |
| Molecular Weight | 435.68 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 3,3-bis(diphenylsilyl)prop-2-enamide |
| SMILES | NC(=O)C=C([SiH](c1ccccc1)c1ccccc1)[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NOSi2/c28-26(29)21-27(30(22-13-5-1-6-14-22)23-15-7-2-8-16-23)31(24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-21,30-31H,(H2,28,29) |
| InChIKey | WHXRFXRFRPPXEB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.68 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|