C15H17NO3Si2 — CID 154225060
3,3-bis(phenoxysilyl)prop-2-enamide (PubChem CID 154225060) has the molecular formula C15H17NO3Si2 and a molecular weight of 315.48 g/mol. Its IUPAC name is 3,3-bis(phenoxysilyl)prop-2-enamide.
| Compound Name | 3,3-bis(phenoxysilyl)prop-2-enamide |
|---|---|
| PubChem CID | 154225060 |
| Molecular Formula | C15H17NO3Si2 |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3,3-bis(phenoxysilyl)prop-2-enamide |
| SMILES | NC(=O)C=C([SiH2]Oc1ccccc1)[SiH2]Oc1ccccc1 |
| InChI | InChI=1S/C15H17NO3Si2/c16-14(17)11-15(20-18-12-7-3-1-4-8-12)21-19-13-9-5-2-6-10-13/h1-11H,20-21H2,(H2,16,17) |
| InChIKey | MAGTUIZENLHWBD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|