About dimethoxy(phenyl)silane;trichloro(methyl)silane
dimethoxy(phenyl)silane;trichloro(methyl)silane (PubChem CID 175302286) has the molecular formula C9H15Cl3O2Si2
and a molecular weight of 317.75 g/mol. Its IUPAC name is dimethoxy(phenyl)silane;trichloro(methyl)silane.
Molecular Properties
| Compound Name | dimethoxy(phenyl)silane;trichloro(methyl)silane |
| PubChem CID | 175302286 |
| Molecular Formula | C9H15Cl3O2Si2 |
| Molecular Weight | 317.75 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | dimethoxy(phenyl)silane;trichloro(methyl)silane |
| SMILES | CO[SiH](OC)c1ccccc1.C[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C8H12O2Si.CH3Cl3Si/c1-9-11(10-2)8-6-4-3-5-7-8;1-5(2,3)4/h3-7,11H,1-2H3;1H3 |
| InChIKey | WTKSECMDEKTJPT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.75 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(phenyl)silane;trichloro(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(phenyl)silane;trichloro(methyl)silane?
The IUPAC name of dimethoxy(phenyl)silane;trichloro(methyl)silane (CID 175302286) is dimethoxy(phenyl)silane;trichloro(methyl)silane.
What is the SMILES notation for dimethoxy(phenyl)silane;trichloro(methyl)silane?
The canonical SMILES for dimethoxy(phenyl)silane;trichloro(methyl)silane is CO[SiH](OC)c1ccccc1.C[Si](Cl)(Cl)Cl.
What is the InChIKey of dimethoxy(phenyl)silane;trichloro(methyl)silane?
The InChIKey is WTKSECMDEKTJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2Si.CH3Cl3Si/c1-9-11(10-2)8-6-4-3-5-7-8;1-5(2,3)4/h3-7,11H,1-2H3;1H3.
What are the key properties of dimethoxy(phenyl)silane;trichloro(methyl)silane?
dimethoxy(phenyl)silane;trichloro(methyl)silane has a molecular weight of 317.75 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(phenyl)silane;trichloro(methyl)silane is sourced from PubChem (CID 175302286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).