About N-dimethoxysilylaniline
N-dimethoxysilylaniline (PubChem CID 154073856) has the molecular formula C8H13NO2Si
and a molecular weight of 183.28 g/mol. Its IUPAC name is N-dimethoxysilylaniline.
Molecular Properties
| Compound Name | N-dimethoxysilylaniline |
| PubChem CID | 154073856 |
| Molecular Formula | C8H13NO2Si |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | N-dimethoxysilylaniline |
| SMILES | CO[SiH](Nc1ccccc1)OC |
| InChI | InChI=1S/C8H13NO2Si/c1-10-12(11-2)9-8-6-4-3-5-7-8/h3-7,9,12H,1-2H3 |
| InChIKey | HXHHWRDFZCMKHA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-dimethoxysilylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-dimethoxysilylaniline?
The IUPAC name of N-dimethoxysilylaniline (CID 154073856) is N-dimethoxysilylaniline.
What is the SMILES notation for N-dimethoxysilylaniline?
The canonical SMILES for N-dimethoxysilylaniline is CO[SiH](Nc1ccccc1)OC.
What is the InChIKey of N-dimethoxysilylaniline?
The InChIKey is HXHHWRDFZCMKHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2Si/c1-10-12(11-2)9-8-6-4-3-5-7-8/h3-7,9,12H,1-2H3.
What are the key properties of N-dimethoxysilylaniline?
N-dimethoxysilylaniline has a molecular weight of 183.28 g/mol, XLogP of 1.11, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-dimethoxysilylaniline is sourced from PubChem (CID 154073856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).