C39H54O6Si7 — CID 58231824
bis[[(dimethylsilyloxy-methyl-phenylsilyl)oxy-methyl-phenylsilyl]oxy]-methyl-phenylsilane (PubChem CID 58231824) has the molecular formula C39H54O6Si7 and a molecular weight of 815.46 g/mol. Its IUPAC name is bis[[(dimethylsilyloxy-methyl-phenylsilyl)oxy-methyl-phenylsilyl]oxy]-methyl-phenylsilane.
| Compound Name | bis[[(dimethylsilyloxy-methyl-phenylsilyl)oxy-methyl-phenylsilyl]oxy]-methyl-phenylsilane |
|---|---|
| PubChem CID | 58231824 |
| Molecular Formula | C39H54O6Si7 |
| Molecular Weight | 815.46 g/mol |
| Exact Mass | 814.23 |
| IUPAC Name | bis[[(dimethylsilyloxy-methyl-phenylsilyl)oxy-methyl-phenylsilyl]oxy]-methyl-phenylsilane |
| SMILES | C[SiH](C)O[Si](C)(O[Si](C)(O[Si](C)(O[Si](C)(O[Si](C)(O[SiH](C)C)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H54O6Si7/c1-46(2)40-48(5,35-25-15-10-16-26-35)42-50(7,37-29-19-12-20-30-37)44-52(9,39-33-23-14-24-34-39)45-51(8,38-31-21-13-22-32-38)43-49(6,41-47(3)4)36-27-17-11-18-28-36/h10-34,46-47H,1-9H3 |
| InChIKey | JOCGLWHTIIPTPD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|