C21H42O6Si7 — CID 157245756
[bis(dimethylsilyloxy)-methylsilyl]oxy-bis(dimethylsilyloxy)silyloxy-diphenylsilane (PubChem CID 157245756) has the molecular formula C21H42O6Si7 and a molecular weight of 587.16 g/mol. Its IUPAC name is [bis(dimethylsilyloxy)-methylsilyl]oxy-bis(dimethylsilyloxy)silyloxy-diphenylsilane.
| Compound Name | [bis(dimethylsilyloxy)-methylsilyl]oxy-bis(dimethylsilyloxy)silyloxy-diphenylsilane |
|---|---|
| PubChem CID | 157245756 |
| Molecular Formula | C21H42O6Si7 |
| Molecular Weight | 587.16 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | [bis(dimethylsilyloxy)-methylsilyl]oxy-bis(dimethylsilyloxy)silyloxy-diphenylsilane |
| SMILES | C[SiH](C)O[SiH](O[SiH](C)C)O[Si](O[Si](C)(O[SiH](C)C)O[SiH](C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H42O6Si7/c1-28(2)22-32(23-29(3)4)26-34(20-16-12-10-13-17-20,21-18-14-11-15-19-21)27-33(9,24-30(5)6)25-31(7)8/h10-19,28-32H,1-9H3 |
| InChIKey | GMAPGLJYBOGIBE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|