C31H54O5Si7 — CID 123894603
bis(dimethylsilyloxy)-[2-[[diphenyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]ethyl-dimethylsilyl]oxy-phenylsilane (PubChem CID 123894603) has the molecular formula C31H54O5Si7 and a molecular weight of 703.37 g/mol. Its IUPAC name is bis(dimethylsilyloxy)-[2-[[diphenyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]ethyl-dimethylsilyl]oxy-phenylsilane.
| Compound Name | bis(dimethylsilyloxy)-[2-[[diphenyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]ethyl-dimethylsilyl]oxy-phenylsilane |
|---|---|
| PubChem CID | 123894603 |
| Molecular Formula | C31H54O5Si7 |
| Molecular Weight | 703.37 g/mol |
| Exact Mass | 702.24 |
| IUPAC Name | bis(dimethylsilyloxy)-[2-[[diphenyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]ethyl-dimethylsilyl]oxy-phenylsilane |
| SMILES | C[SiH](C)O[Si](O[SiH](C)C)(O[Si](C)(C)CC[Si](C)(C)O[Si](O[Si](C)(C)C)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H54O5Si7/c1-37(2)32-43(33-38(3)4,31-25-19-14-20-26-31)36-41(10,11)28-27-40(8,9)35-42(34-39(5,6)7,29-21-15-12-16-22-29)30-23-17-13-18-24-30/h12-26,37-38H,27-28H2,1-11H3 |
| InChIKey | QHCNODUDHNQQAF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.37 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|