C17H26O4Si3 — CID 159105733
dimethoxysilyloxy-diphenyl-trimethylsilyloxysilane (PubChem CID 159105733) has the molecular formula C17H26O4Si3 and a molecular weight of 378.65 g/mol. Its IUPAC name is dimethoxysilyloxy-diphenyl-trimethylsilyloxysilane.
| Compound Name | dimethoxysilyloxy-diphenyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 159105733 |
| Molecular Formula | C17H26O4Si3 |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | dimethoxysilyloxy-diphenyl-trimethylsilyloxysilane |
| SMILES | CO[SiH](OC)O[Si](O[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H26O4Si3/c1-18-22(19-2)20-24(21-23(3,4)5,16-12-8-6-9-13-16)17-14-10-7-11-15-17/h6-15,22H,1-5H3 |
| InChIKey | HBOCSZXRTSYAAS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|