C27H29O2Si3 — CID 58825826
CID 58825826 (PubChem CID 58825826) has the molecular formula C27H29O2Si3 and a molecular weight of 469.79 g/mol.
| Compound Name | CID 58825826 |
|---|---|
| PubChem CID | 58825826 |
| Molecular Formula | C27H29O2Si3 |
| Molecular Weight | 469.79 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)O[Si](O[Si](c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29O2Si3/c1-31(2,3)29-32(26-20-12-6-13-21-26,27-22-14-7-15-23-27)28-30(24-16-8-4-9-17-24)25-18-10-5-11-19-25/h4-23H,1-3H3 |
| InChIKey | MKSJUQSFJZDMGN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.79 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|