C25H41NO3Si3 — CID 20652817
N-[3-[[diphenyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]-2-methylbutanamide (PubChem CID 20652817) has the molecular formula C25H41NO3Si3 and a molecular weight of 487.87 g/mol. Its IUPAC name is N-[3-[[diphenyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]-2-methylbutanamide.
| Compound Name | N-[3-[[diphenyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 20652817 |
| Molecular Formula | C25H41NO3Si3 |
| Molecular Weight | 487.87 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | N-[3-[[diphenyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]propyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)NCCC[Si](C)(C)O[Si](O[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H41NO3Si3/c1-8-22(2)25(27)26-20-15-21-31(6,7)29-32(28-30(3,4)5,23-16-11-9-12-17-23)24-18-13-10-14-19-24/h9-14,16-19,22H,8,15,20-21H2,1-7H3,(H,26,27) |
| InChIKey | UCTLUGLWPQVFLN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.87 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|