C24H34N2O5Si — CID 59439700
2-[3-[methyl(diphenoxy)silyl]propylcarbamoylamino]ethyl 2-methylbutanoate (PubChem CID 59439700) has the molecular formula C24H34N2O5Si and a molecular weight of 458.63 g/mol. Its IUPAC name is 2-[3-[methyl(diphenoxy)silyl]propylcarbamoylamino]ethyl 2-methylbutanoate.
| Compound Name | 2-[3-[methyl(diphenoxy)silyl]propylcarbamoylamino]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 59439700 |
| Molecular Formula | C24H34N2O5Si |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 2-[3-[methyl(diphenoxy)silyl]propylcarbamoylamino]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCNC(=O)NCCC[Si](C)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C24H34N2O5Si/c1-4-20(2)23(27)29-18-17-26-24(28)25-16-11-19-32(3,30-21-12-7-5-8-13-21)31-22-14-9-6-10-15-22/h5-10,12-15,20H,4,11,16-19H2,1-3H3,(H2,25,26,28) |
| InChIKey | BXTKFAZWGSOOIO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|